C12H11N5S — CID 43732043
3-(2H-tetrazol-5-yl)-N-(thiophen-2-ylmethyl)aniline (PubChem CID 43732043) has the molecular formula C12H11N5S and a molecular weight of 257.32 g/mol. Its IUPAC name is 3-(2H-tetrazol-5-yl)-N-(thiophen-2-ylmethyl)aniline.
| Compound Name | 3-(2H-tetrazol-5-yl)-N-(thiophen-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43732043 |
| Molecular Formula | C12H11N5S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 3-(2H-tetrazol-5-yl)-N-(thiophen-2-ylmethyl)aniline |
| SMILES | c1cc(NCc2cccs2)cc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C12H11N5S/c1-3-9(12-14-16-17-15-12)7-10(4-1)13-8-11-5-2-6-18-11/h1-7,13H,8H2,(H,14,15,16,17) |
| InChIKey | VPAXJJPOJKSDIP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |