C13H13N3O2S — CID 28711815
5-(thiophen-2-ylmethylamino)benzene-1,3-dicarboxamide (PubChem CID 28711815) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 5-(thiophen-2-ylmethylamino)benzene-1,3-dicarboxamide.
| Compound Name | 5-(thiophen-2-ylmethylamino)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 28711815 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 5-(thiophen-2-ylmethylamino)benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(NCc2cccs2)cc(C(N)=O)c1 |
| InChI | InChI=1S/C13H13N3O2S/c14-12(17)8-4-9(13(15)18)6-10(5-8)16-7-11-2-1-3-19-11/h1-6,16H,7H2,(H2,14,17)(H2,15,18) |
| InChIKey | VAZBFZZIWIOBSW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |