C18H13ClN4O2S2 — CID 161391140
5-[3-[[5-(2-chlorophenyl)thiophen-2-yl]sulfonylmethyl]phenyl]-2H-tetrazole (PubChem CID 161391140) has the molecular formula C18H13ClN4O2S2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 5-[3-[[5-(2-chlorophenyl)thiophen-2-yl]sulfonylmethyl]phenyl]-2H-tetrazole.
| Compound Name | 5-[3-[[5-(2-chlorophenyl)thiophen-2-yl]sulfonylmethyl]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 161391140 |
| Molecular Formula | C18H13ClN4O2S2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 5-[3-[[5-(2-chlorophenyl)thiophen-2-yl]sulfonylmethyl]phenyl]-2H-tetrazole |
| SMILES | O=S(=O)(Cc1cccc(-c2nn[nH]n2)c1)c1ccc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C18H13ClN4O2S2/c19-15-7-2-1-6-14(15)16-8-9-17(26-16)27(24,25)11-12-4-3-5-13(10-12)18-20-22-23-21-18/h1-10H,11H2,(H,20,21,22,23) |
| InChIKey | VSZROYVKSKWZBE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |