C17H12ClN5O2S — CID 166400588
3-chloro-N-[2-(2H-tetrazol-5-yl)phenyl]naphthalene-2-sulfonamide (PubChem CID 166400588) has the molecular formula C17H12ClN5O2S and a molecular weight of 385.84 g/mol. Its IUPAC name is 3-chloro-N-[2-(2H-tetrazol-5-yl)phenyl]naphthalene-2-sulfonamide.
| Compound Name | 3-chloro-N-[2-(2H-tetrazol-5-yl)phenyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 166400588 |
| Molecular Formula | C17H12ClN5O2S |
| Molecular Weight | 385.84 g/mol |
| Exact Mass | 385.04 |
| IUPAC Name | 3-chloro-N-[2-(2H-tetrazol-5-yl)phenyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1-c1nn[nH]n1)c1cc2ccccc2cc1Cl |
| InChI | InChI=1S/C17H12ClN5O2S/c18-14-9-11-5-1-2-6-12(11)10-16(14)26(24,25)21-15-8-4-3-7-13(15)17-19-22-23-20-17/h1-10,21H,(H,19,20,22,23) |
| InChIKey | SDBLHJRDNYXVCF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |