C20H14ClN5O — CID 68576695
N-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-naphthalen-2-ylprop-2-enamide (PubChem CID 68576695) has the molecular formula C20H14ClN5O and a molecular weight of 375.82 g/mol. Its IUPAC name is N-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-naphthalen-2-ylprop-2-enamide.
| Compound Name | N-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-naphthalen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 68576695 |
| Molecular Formula | C20H14ClN5O |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | N-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-naphthalen-2-ylprop-2-enamide |
| SMILES | O=C(C=Cc1ccc2ccccc2c1)Nc1cc(Cl)ccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C20H14ClN5O/c21-16-8-9-17(20-23-25-26-24-20)18(12-16)22-19(27)10-6-13-5-7-14-3-1-2-4-15(14)11-13/h1-12H,(H,22,27)(H,23,24,25,26) |
| InChIKey | CGZOSWPLTVPHKY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|