C21H17ClN2O4S — CID 25064762
4-chloro-N-methylsulfonyl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]benzamide (PubChem CID 25064762) has the molecular formula C21H17ClN2O4S and a molecular weight of 428.90 g/mol. Its IUPAC name is 4-chloro-N-methylsulfonyl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]benzamide.
| Compound Name | 4-chloro-N-methylsulfonyl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 25064762 |
| Molecular Formula | C21H17ClN2O4S |
| Molecular Weight | 428.90 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 4-chloro-N-methylsulfonyl-2-[[(E)-3-naphthalen-2-ylprop-2-enoyl]amino]benzamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc(Cl)cc1NC(=O)/C=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H17ClN2O4S/c1-29(27,28)24-21(26)18-10-9-17(22)13-19(18)23-20(25)11-7-14-6-8-15-4-2-3-5-16(15)12-14/h2-13H,1H3,(H,23,25)(H,24,26)/b11-7+ |
| InChIKey | VRHIQTXQOPZMJT-YRNVUSSQSA-N |
| XLogP | 3.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.90 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|