C24H22ClN5O2 — CID 143697600
(E)-N-[5-chloro-2-(2H-tetrazol-5-ylmethoxy)phenyl]-3-naphthalen-2-ylprop-2-enamide;prop-1-ene (PubChem CID 143697600) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is (E)-N-[5-chloro-2-(2H-tetrazol-5-ylmethoxy)phenyl]-3-naphthalen-2-ylprop-2-enamide;prop-1-ene.
| Compound Name | (E)-N-[5-chloro-2-(2H-tetrazol-5-ylmethoxy)phenyl]-3-naphthalen-2-ylprop-2-enamide;prop-1-ene |
|---|---|
| PubChem CID | 143697600 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | (E)-N-[5-chloro-2-(2H-tetrazol-5-ylmethoxy)phenyl]-3-naphthalen-2-ylprop-2-enamide;prop-1-ene |
| SMILES | C=CC.O=C(/C=C/c1ccc2ccccc2c1)Nc1cc(Cl)ccc1OCc1nn[nH]n1 |
| InChI | InChI=1S/C21H16ClN5O2.C3H6/c22-17-8-9-19(29-13-20-24-26-27-25-20)18(12-17)23-21(28)10-6-14-5-7-15-3-1-2-4-16(15)11-14;1-3-2/h1-12H,13H2,(H,23,28)(H,24,25,26,27);3H,1H2,2H3/b10-6+; |
| InChIKey | FRZIHBMPKRROJA-AAGWESIMSA-N |
| XLogP | 5.43 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|