C14H9Cl3N6O — CID 10407640
1-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 10407640) has the molecular formula C14H9Cl3N6O and a molecular weight of 383.63 g/mol. Its IUPAC name is 1-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 10407640 |
| Molecular Formula | C14H9Cl3N6O |
| Molecular Weight | 383.63 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | 1-[5-chloro-2-(2H-tetrazol-5-yl)phenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1cc(Cl)ccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C14H9Cl3N6O/c15-7-1-2-11(13-20-22-23-21-13)12(6-7)19-14(24)18-10-4-8(16)3-9(17)5-10/h1-6H,(H2,18,19,24)(H,20,21,22,23) |
| InChIKey | LIIMJYLIMXABQB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.63 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |