C18H17N5O3 — CID 89187960
(E)-3-[3,4-bis(hydroxymethyl)phenyl]-N-[2-(2H-tetrazol-5-yl)phenyl]prop-2-enamide (PubChem CID 89187960) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is (E)-3-[3,4-bis(hydroxymethyl)phenyl]-N-[2-(2H-tetrazol-5-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3,4-bis(hydroxymethyl)phenyl]-N-[2-(2H-tetrazol-5-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 89187960 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (E)-3-[3,4-bis(hydroxymethyl)phenyl]-N-[2-(2H-tetrazol-5-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(CO)c(CO)c1)Nc1ccccc1-c1nn[nH]n1 |
| InChI | InChI=1S/C18H17N5O3/c24-10-13-7-5-12(9-14(13)11-25)6-8-17(26)19-16-4-2-1-3-15(16)18-20-22-23-21-18/h1-9,24-25H,10-11H2,(H,19,26)(H,20,21,22,23)/b8-6+ |
| InChIKey | LWOHAJHJDIGYGC-SOFGYWHQSA-N |
| XLogP | 1.50 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|