C18H17NO5 — CID 76748475
[2-[3-[3,4-bis(hydroxymethyl)phenyl]prop-2-enoylamino]phenyl] formate (PubChem CID 76748475) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is [2-[3-[3,4-bis(hydroxymethyl)phenyl]prop-2-enoylamino]phenyl] formate.
| Compound Name | [2-[3-[3,4-bis(hydroxymethyl)phenyl]prop-2-enoylamino]phenyl] formate |
|---|---|
| PubChem CID | 76748475 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | [2-[3-[3,4-bis(hydroxymethyl)phenyl]prop-2-enoylamino]phenyl] formate |
| SMILES | O=COc1ccccc1NC(=O)C=Cc1ccc(CO)c(CO)c1 |
| InChI | InChI=1S/C18H17NO5/c20-10-14-7-5-13(9-15(14)11-21)6-8-18(23)19-16-3-1-2-4-17(16)24-12-22/h1-9,12,20-21H,10-11H2,(H,19,23) |
| InChIKey | UMBHSQFCMWXSFN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|