C16H11N5O2 — CID 137333040
2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]isoindole-1,3-dione (PubChem CID 137333040) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 137333040 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[[3-(2H-tetrazol-5-yl)phenyl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C16H11N5O2/c22-15-12-6-1-2-7-13(12)16(23)21(15)9-10-4-3-5-11(8-10)14-17-19-20-18-14/h1-8H,9H2,(H,17,18,19,20) |
| InChIKey | PWCUNBBRJUDGEQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|