About 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole)
5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) (PubChem CID 157257840) has the molecular formula C24H24N12
and a molecular weight of 480.54 g/mol. Its IUPAC name is 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole).
Molecular Properties
| Compound Name | 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) |
| PubChem CID | 157257840 |
| Molecular Formula | C24H24N12 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) |
| SMILES | Cc1ccc(-c2nn[nH]n2)cc1.Cc1ccc(-c2nn[nH]n2)cc1.Cc1cccc(-c2nn[nH]n2)c1 |
| InChI | InChI=1S/3C8H8N4/c2*1-6-2-4-7(5-3-6)8-9-11-12-10-8;1-6-3-2-4-7(5-6)8-9-11-12-10-8/h3*2-5H,1H3,(H,9,10,11,12) |
| InChIKey | AXCFXECUJNZAQR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 163.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole)?
The IUPAC name of 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) (CID 157257840) is 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole).
What is the SMILES notation for 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole)?
The canonical SMILES for 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) is Cc1ccc(-c2nn[nH]n2)cc1.Cc1ccc(-c2nn[nH]n2)cc1.Cc1cccc(-c2nn[nH]n2)c1.
What is the InChIKey of 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole)?
The InChIKey is AXCFXECUJNZAQR-UHFFFAOYSA-N. The full InChI is InChI=1S/3C8H8N4/c2*1-6-2-4-7(5-3-6)8-9-11-12-10-8;1-6-3-2-4-7(5-6)8-9-11-12-10-8/h3*2-5H,1H3,(H,9,10,11,12).
What are the key properties of 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole)?
5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) has a molecular weight of 480.54 g/mol, XLogP of 3.53, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylphenyl)-2H-tetrazole;bis(5-(4-methylphenyl)-2H-tetrazole) is sourced from PubChem (CID 157257840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).