C15H14ClF3N2O2S — CID 3588052
2-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 3588052) has the molecular formula C15H14ClF3N2O2S and a molecular weight of 378.80 g/mol. Its IUPAC name is 2-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3588052 |
| Molecular Formula | C15H14ClF3N2O2S |
| Molecular Weight | 378.80 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-chloro-N-methyl-N-(2-pyridin-2-ylethyl)-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C15H14ClF3N2O2S/c1-21(9-7-12-4-2-3-8-20-12)24(22,23)14-10-11(15(17,18)19)5-6-13(14)16/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | RYEZDHBSRBSWGL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |