C15H14F4N2O2S — CID 52746563
4-fluoro-N-methyl-N-(2-pyridin-2-ylethyl)-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 52746563) has the molecular formula C15H14F4N2O2S and a molecular weight of 362.35 g/mol. Its IUPAC name is 4-fluoro-N-methyl-N-(2-pyridin-2-ylethyl)-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 4-fluoro-N-methyl-N-(2-pyridin-2-ylethyl)-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 52746563 |
| Molecular Formula | C15H14F4N2O2S |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-fluoro-N-methyl-N-(2-pyridin-2-ylethyl)-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14F4N2O2S/c1-21(9-7-11-4-2-3-8-20-11)24(22,23)12-5-6-14(16)13(10-12)15(17,18)19/h2-6,8,10H,7,9H2,1H3 |
| InChIKey | WFMMGXCONKCBSY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |