C15H15F3N2O3S — CID 52552426
N-methyl-N-(2-pyridin-2-ylethyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 52552426) has the molecular formula C15H15F3N2O3S and a molecular weight of 360.36 g/mol. Its IUPAC name is N-methyl-N-(2-pyridin-2-ylethyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-methyl-N-(2-pyridin-2-ylethyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 52552426 |
| Molecular Formula | C15H15F3N2O3S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | N-methyl-N-(2-pyridin-2-ylethyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CN(CCc1ccccn1)S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O3S/c1-20(11-9-12-6-4-5-10-19-12)24(21,22)14-8-3-2-7-13(14)23-15(16,17)18/h2-8,10H,9,11H2,1H3 |
| InChIKey | OAFYXGXHCPGGBW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |