C13H18F3NO5S — CID 55512150
N,N-bis(2-methoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide (PubChem CID 55512150) has the molecular formula C13H18F3NO5S and a molecular weight of 357.35 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N,N-bis(2-methoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 55512150 |
| Molecular Formula | C13H18F3NO5S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-(trifluoromethoxy)benzenesulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H18F3NO5S/c1-20-9-7-17(8-10-21-2)23(18,19)12-6-4-3-5-11(12)22-13(14,15)16/h3-6H,7-10H2,1-2H3 |
| InChIKey | CXIOFVBYCPQPLJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |