C11H13F3N2O4S — CID 31075623
N-methyl-2-[methyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]acetamide (PubChem CID 31075623) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is N-methyl-2-[methyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]acetamide.
| Compound Name | N-methyl-2-[methyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 31075623 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | N-methyl-2-[methyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
| SMILES | CNC(=O)CN(C)S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O4S/c1-15-10(17)7-16(2)21(18,19)9-6-4-3-5-8(9)20-11(12,13)14/h3-6H,7H2,1-2H3,(H,15,17) |
| InChIKey | FQTQLOZGHGECOW-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |