C14H19F3N2O4S — CID 9189126
N-tert-butyl-2-[methyl-[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide (PubChem CID 9189126) has the molecular formula C14H19F3N2O4S and a molecular weight of 368.38 g/mol. Its IUPAC name is N-tert-butyl-2-[methyl-[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide.
| Compound Name | N-tert-butyl-2-[methyl-[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
|---|---|
| PubChem CID | 9189126 |
| Molecular Formula | C14H19F3N2O4S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | N-tert-butyl-2-[methyl-[4-(trifluoromethoxy)phenyl]sulfonylamino]acetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)S(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H19F3N2O4S/c1-13(2,3)18-12(20)9-19(4)24(21,22)11-7-5-10(6-8-11)23-14(15,16)17/h5-8H,9H2,1-4H3,(H,18,20) |
| InChIKey | GULUERWZAAQLAE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |