C13H18BrClN2O3S — CID 106545297
2-[(3-bromo-4-chlorophenyl)sulfonyl-methylamino]-N-tert-butylacetamide (PubChem CID 106545297) has the molecular formula C13H18BrClN2O3S and a molecular weight of 397.72 g/mol. Its IUPAC name is 2-[(3-bromo-4-chlorophenyl)sulfonyl-methylamino]-N-tert-butylacetamide.
| Compound Name | 2-[(3-bromo-4-chlorophenyl)sulfonyl-methylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 106545297 |
| Molecular Formula | C13H18BrClN2O3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-[(3-bromo-4-chlorophenyl)sulfonyl-methylamino]-N-tert-butylacetamide |
| SMILES | CN(CC(=O)NC(C)(C)C)S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H18BrClN2O3S/c1-13(2,3)16-12(18)8-17(4)21(19,20)9-5-6-11(15)10(14)7-9/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | PZEQYRTVEOJWQQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |