C13H17BrClNO4S — CID 106605247
3-[(3-bromo-4-chlorophenyl)sulfonyl-tert-butylamino]propanoic acid (PubChem CID 106605247) has the molecular formula C13H17BrClNO4S and a molecular weight of 398.71 g/mol. Its IUPAC name is 3-[(3-bromo-4-chlorophenyl)sulfonyl-tert-butylamino]propanoic acid.
| Compound Name | 3-[(3-bromo-4-chlorophenyl)sulfonyl-tert-butylamino]propanoic acid |
|---|---|
| PubChem CID | 106605247 |
| Molecular Formula | C13H17BrClNO4S |
| Molecular Weight | 398.71 g/mol |
| Exact Mass | 396.98 |
| IUPAC Name | 3-[(3-bromo-4-chlorophenyl)sulfonyl-tert-butylamino]propanoic acid |
| SMILES | CC(C)(C)N(CCC(=O)O)S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H17BrClNO4S/c1-13(2,3)16(7-6-12(17)18)21(19,20)9-4-5-11(15)10(14)8-9/h4-5,8H,6-7H2,1-3H3,(H,17,18) |
| InChIKey | AFCTXFSIGAIXKC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |