C10H11BrClN3O4S — CID 106546067
2-[(2-amino-2-oxoethyl)-(3-bromo-4-chlorophenyl)sulfonylamino]acetamide (PubChem CID 106546067) has the molecular formula C10H11BrClN3O4S and a molecular weight of 384.64 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-(3-bromo-4-chlorophenyl)sulfonylamino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-(3-bromo-4-chlorophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 106546067 |
| Molecular Formula | C10H11BrClN3O4S |
| Molecular Weight | 384.64 g/mol |
| Exact Mass | 382.93 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-(3-bromo-4-chlorophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)S(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C10H11BrClN3O4S/c11-7-3-6(1-2-8(7)12)20(18,19)15(4-9(13)16)5-10(14)17/h1-3H,4-5H2,(H2,13,16)(H2,14,17) |
| InChIKey | XRHWLDJTVTYOJY-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 123.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.64 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |