C9H11BrN4O4S — CID 62921775
2-[(2-amino-2-oxoethyl)-[(5-bromo-3-pyridinyl)sulfonyl]amino]acetamide (PubChem CID 62921775) has the molecular formula C9H11BrN4O4S and a molecular weight of 351.18 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[(5-bromo-3-pyridinyl)sulfonyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[(5-bromo-3-pyridinyl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 62921775 |
| Molecular Formula | C9H11BrN4O4S |
| Molecular Weight | 351.18 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[(5-bromo-3-pyridinyl)sulfonyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)S(=O)(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C9H11BrN4O4S/c10-6-1-7(3-13-2-6)19(17,18)14(4-8(11)15)5-9(12)16/h1-3H,4-5H2,(H2,11,15)(H2,12,16) |
| InChIKey | PYSCEKNYYRAWRU-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 136.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.18 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |