C12H15BrClNO4S — CID 106605335
4-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 106605335) has the molecular formula C12H15BrClNO4S and a molecular weight of 384.68 g/mol. Its IUPAC name is 4-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 106605335 |
| Molecular Formula | C12H15BrClNO4S |
| Molecular Weight | 384.68 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 4-[(3-bromo-4-chlorophenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NS(=O)(=O)c1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C12H15BrClNO4S/c1-12(2,6-5-11(16)17)15-20(18,19)8-3-4-10(14)9(13)7-8/h3-4,7,15H,5-6H2,1-2H3,(H,16,17) |
| InChIKey | BACJXSILVXTKQT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.68 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |