C12H15Cl2NO4S — CID 62044183
4-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 62044183) has the molecular formula C12H15Cl2NO4S and a molecular weight of 340.23 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 4-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62044183 |
| Molecular Formula | C12H15Cl2NO4S |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO4S/c1-12(2,7-6-10(16)17)15-20(18,19)11-8(13)4-3-5-9(11)14/h3-5,15H,6-7H2,1-2H3,(H,16,17) |
| InChIKey | UKERGRSODAVZFQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |