C22H26F3NO6S2 — CID 58713174
2-[2-methyl-4-[3-[propyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]propylsulfanyl]phenoxy]acetic acid (PubChem CID 58713174) has the molecular formula C22H26F3NO6S2 and a molecular weight of 521.58 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-[propyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]propylsulfanyl]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[3-[propyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]propylsulfanyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 58713174 |
| Molecular Formula | C22H26F3NO6S2 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2-[2-methyl-4-[3-[propyl-[2-(trifluoromethoxy)phenyl]sulfonylamino]propylsulfanyl]phenoxy]acetic acid |
| SMILES | CCCN(CCCSc1ccc(OCC(=O)O)c(C)c1)S(=O)(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C22H26F3NO6S2/c1-3-11-26(34(29,30)20-8-5-4-7-19(20)32-22(23,24)25)12-6-13-33-17-9-10-18(16(2)14-17)31-15-21(27)28/h4-5,7-10,14H,3,6,11-13,15H2,1-2H3,(H,27,28) |
| InChIKey | VODYQIZLJWKXDT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|