C22H20F3NO5S — CID 90825522
2-[2-methyl-4-[3-[4-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]propoxy]phenoxy]acetic acid (PubChem CID 90825522) has the molecular formula C22H20F3NO5S and a molecular weight of 467.47 g/mol. Its IUPAC name is 2-[2-methyl-4-[3-[4-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]propoxy]phenoxy]acetic acid.
| Compound Name | 2-[2-methyl-4-[3-[4-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]propoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 90825522 |
| Molecular Formula | C22H20F3NO5S |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | 2-[2-methyl-4-[3-[4-[2-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]propoxy]phenoxy]acetic acid |
| SMILES | Cc1cc(OCCCc2nc(-c3ccccc3OC(F)(F)F)cs2)ccc1OCC(=O)O |
| InChI | InChI=1S/C22H20F3NO5S/c1-14-11-15(8-9-18(14)30-12-21(27)28)29-10-4-7-20-26-17(13-32-20)16-5-2-3-6-19(16)31-22(23,24)25/h2-3,5-6,8-9,11,13H,4,7,10,12H2,1H3,(H,27,28) |
| InChIKey | YPOBOPOXPJZSFH-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|