C26H30F3NO4S — CID 143460163
ethane;2-[2-methyl-4-[4-[5-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butoxy]phenoxy]acetic acid (PubChem CID 143460163) has the molecular formula C26H30F3NO4S and a molecular weight of 509.59 g/mol. Its IUPAC name is ethane;2-[2-methyl-4-[4-[5-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butoxy]phenoxy]acetic acid.
| Compound Name | ethane;2-[2-methyl-4-[4-[5-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 143460163 |
| Molecular Formula | C26H30F3NO4S |
| Molecular Weight | 509.59 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | ethane;2-[2-methyl-4-[4-[5-methyl-4-[4-(trifluoromethyl)phenyl]-1,3-thiazol-2-yl]butoxy]phenoxy]acetic acid |
| SMILES | CC.Cc1cc(OCCCCc2nc(-c3ccc(C(F)(F)F)cc3)c(C)s2)ccc1OCC(=O)O |
| InChI | InChI=1S/C24H24F3NO4S.C2H6/c1-15-13-19(10-11-20(15)32-14-22(29)30)31-12-4-3-5-21-28-23(16(2)33-21)17-6-8-18(9-7-17)24(25,26)27;1-2/h6-11,13H,3-5,12,14H2,1-2H3,(H,29,30);1-2H3 |
| InChIKey | SDJTVDUCJRJBIZ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|