C20H24F3N5O2 — CID 111847873
N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide (PubChem CID 111847873) has the molecular formula C20H24F3N5O2 and a molecular weight of 423.44 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
|---|---|
| PubChem CID | 111847873 |
| Molecular Formula | C20H24F3N5O2 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2-pyridin-2-ylethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CCc1ccccn1)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H24F3N5O2/c1-24-19(26-13-15-7-3-4-9-17(15)30-20(21,22)23)27-14-18(29)28(2)12-10-16-8-5-6-11-25-16/h3-9,11H,10,12-14H2,1-2H3,(H2,24,26,27) |
| InChIKey | INJFNELGLFYNTR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|