C15H18F6N4O2 — CID 111671010
N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111671010) has the molecular formula C15H18F6N4O2 and a molecular weight of 400.32 g/mol. Its IUPAC name is N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111671010 |
| Molecular Formula | C15H18F6N4O2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-methyl-2-[[N'-methyl-N-[[2-(trifluoromethoxy)phenyl]methyl]carbamimidoyl]amino]-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H18F6N4O2/c1-22-13(24-8-12(26)25(2)9-14(16,17)18)23-7-10-5-3-4-6-11(10)27-15(19,20)21/h3-6H,7-9H2,1-2H3,(H2,22,23,24) |
| InChIKey | ZZBPBEOQCIRXNS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|