C19H18N2O5S2 — CID 55645155
2-methylsulfonyl-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide (PubChem CID 55645155) has the molecular formula C19H18N2O5S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide.
| Compound Name | 2-methylsulfonyl-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 55645155 |
| Molecular Formula | C19H18N2O5S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.07 |
| IUPAC Name | 2-methylsulfonyl-N-[3-(pyridin-2-ylmethoxy)phenyl]benzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)Nc1cccc(OCc2ccccn2)c1 |
| InChI | InChI=1S/C19H18N2O5S2/c1-27(22,23)18-10-2-3-11-19(18)28(24,25)21-15-8-6-9-17(13-15)26-14-16-7-4-5-12-20-16/h2-13,21H,14H2,1H3 |
| InChIKey | AIEVJSLRPGRUHJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |