C19H15Cl2NO3S — CID 122187088
2,6-dichloro-N-(3-phenylmethoxyphenyl)benzenesulfonamide (PubChem CID 122187088) has the molecular formula C19H15Cl2NO3S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-phenylmethoxyphenyl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(3-phenylmethoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 122187088 |
| Molecular Formula | C19H15Cl2NO3S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 2,6-dichloro-N-(3-phenylmethoxyphenyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(OCc2ccccc2)c1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H15Cl2NO3S/c20-17-10-5-11-18(21)19(17)26(23,24)22-15-8-4-9-16(12-15)25-13-14-6-2-1-3-7-14/h1-12,22H,13H2 |
| InChIKey | NJSJUCYNXWELJT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |