C18H15ClFN3O3S — CID 166328062
2-amino-5-chloro-N-[3-[(4-fluorophenyl)methoxy]phenyl]pyridine-3-sulfonamide (PubChem CID 166328062) has the molecular formula C18H15ClFN3O3S and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-amino-5-chloro-N-[3-[(4-fluorophenyl)methoxy]phenyl]pyridine-3-sulfonamide.
| Compound Name | 2-amino-5-chloro-N-[3-[(4-fluorophenyl)methoxy]phenyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 166328062 |
| Molecular Formula | C18H15ClFN3O3S |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 2-amino-5-chloro-N-[3-[(4-fluorophenyl)methoxy]phenyl]pyridine-3-sulfonamide |
| SMILES | Nc1ncc(Cl)cc1S(=O)(=O)Nc1cccc(OCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C18H15ClFN3O3S/c19-13-8-17(18(21)22-10-13)27(24,25)23-15-2-1-3-16(9-15)26-11-12-4-6-14(20)7-5-12/h1-10,23H,11H2,(H2,21,22) |
| InChIKey | LCGFSPWAMUPLGG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |