C26H22FN3O4S — CID 46477862
2-[(4-fluorophenyl)sulfonylamino]-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide (PubChem CID 46477862) has the molecular formula C26H22FN3O4S and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 46477862 |
| Molecular Formula | C26H22FN3O4S |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.13 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)c1ccccc1NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H22FN3O4S/c27-20-11-13-23(14-12-20)35(32,33)30-25-10-2-1-9-24(25)26(31)29-17-19-6-5-8-22(16-19)34-18-21-7-3-4-15-28-21/h1-16,30H,17-18H2,(H,29,31) |
| InChIKey | LZJHYLHFVVSZHI-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |