C26H25N3O2 — CID 46477911
N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 46477911) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 46477911 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[[3-(pyridin-2-ylmethoxy)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | O=C(NCc1cccc(OCc2ccccn2)c1)c1cccc2c3c([nH]c12)CCCC3 |
| InChI | InChI=1S/C26H25N3O2/c30-26(23-12-6-11-22-21-10-1-2-13-24(21)29-25(22)23)28-16-18-7-5-9-20(15-18)31-17-19-8-3-4-14-27-19/h3-9,11-12,14-15,29H,1-2,10,13,16-17H2,(H,28,30) |
| InChIKey | GZLUWFKTDMRHAG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|