C25H23N3O2 — CID 33498777
N-[3-(pyridin-2-ylmethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide (PubChem CID 33498777) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is N-[3-(pyridin-2-ylmethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide.
| Compound Name | N-[3-(pyridin-2-ylmethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
|---|---|
| PubChem CID | 33498777 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[3-(pyridin-2-ylmethoxy)phenyl]-6,7,8,9-tetrahydro-5H-carbazole-3-carboxamide |
| SMILES | O=C(Nc1cccc(OCc2ccccn2)c1)c1ccc2[nH]c3c(c2c1)CCCC3 |
| InChI | InChI=1S/C25H23N3O2/c29-25(17-11-12-24-22(14-17)21-9-1-2-10-23(21)28-24)27-18-7-5-8-20(15-18)30-16-19-6-3-4-13-26-19/h3-8,11-15,28H,1-2,9-10,16H2,(H,27,29) |
| InChIKey | YBGFHCMXRALCDL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|