C25H20FN3O4S — CID 38669447
3-[(4-fluorophenyl)sulfamoyl]-N-[3-(pyridin-2-ylmethoxy)phenyl]benzamide (PubChem CID 38669447) has the molecular formula C25H20FN3O4S and a molecular weight of 477.52 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfamoyl]-N-[3-(pyridin-2-ylmethoxy)phenyl]benzamide.
| Compound Name | 3-[(4-fluorophenyl)sulfamoyl]-N-[3-(pyridin-2-ylmethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 38669447 |
| Molecular Formula | C25H20FN3O4S |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.12 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfamoyl]-N-[3-(pyridin-2-ylmethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(OCc2ccccn2)c1)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H20FN3O4S/c26-19-10-12-20(13-11-19)29-34(31,32)24-9-3-5-18(15-24)25(30)28-21-7-4-8-23(16-21)33-17-22-6-1-2-14-27-22/h1-16,29H,17H2,(H,28,30) |
| InChIKey | KEARMDLDWKHXDT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |