C23H17FN4O3S — CID 134056280
3-[(4-fluorophenyl)sulfamoyl]-N-(2-phenylpyrimidin-5-yl)benzamide (PubChem CID 134056280) has the molecular formula C23H17FN4O3S and a molecular weight of 448.48 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)sulfamoyl]-N-(2-phenylpyrimidin-5-yl)benzamide.
| Compound Name | 3-[(4-fluorophenyl)sulfamoyl]-N-(2-phenylpyrimidin-5-yl)benzamide |
|---|---|
| PubChem CID | 134056280 |
| Molecular Formula | C23H17FN4O3S |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[(4-fluorophenyl)sulfamoyl]-N-(2-phenylpyrimidin-5-yl)benzamide |
| SMILES | O=C(Nc1cnc(-c2ccccc2)nc1)c1cccc(S(=O)(=O)Nc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H17FN4O3S/c24-18-9-11-19(12-10-18)28-32(30,31)21-8-4-7-17(13-21)23(29)27-20-14-25-22(26-15-20)16-5-2-1-3-6-16/h1-15,28H,(H,27,29) |
| InChIKey | QDGRGKGFWOIRME-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |