C25H29N3O2 — CID 55868770
N-[[3-(2-methylbutanoylamino)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 55868770) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[[3-(2-methylbutanoylamino)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-[[3-(2-methylbutanoylamino)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 55868770 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | N-[[3-(2-methylbutanoylamino)phenyl]methyl]-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CCC(C)C(=O)Nc1cccc(CNC(=O)c2cccc3c4c([nH]c23)CCCC4)c1 |
| InChI | InChI=1S/C25H29N3O2/c1-3-16(2)24(29)27-18-9-6-8-17(14-18)15-26-25(30)21-12-7-11-20-19-10-4-5-13-22(19)28-23(20)21/h6-9,11-12,14,16,28H,3-5,10,13,15H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | TWSJDTSYXHIQGS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|