C22H24N2O4 — CID 34979408
N-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 34979408) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 34979408 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-(3,4,5-trimethoxyphenyl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | COc1cc(NC(=O)c2cccc3c4c([nH]c23)CCCC4)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N2O4/c1-26-18-11-13(12-19(27-2)21(18)28-3)23-22(25)16-9-6-8-15-14-7-4-5-10-17(14)24-20(15)16/h6,8-9,11-12,24H,4-5,7,10H2,1-3H3,(H,23,25) |
| InChIKey | CZLMICXNZMTRKX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|