C22H22N2O4 — CID 46416882
methyl 2-[3-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonylamino)phenoxy]acetate (PubChem CID 46416882) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl 2-[3-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonylamino)phenoxy]acetate.
| Compound Name | methyl 2-[3-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonylamino)phenoxy]acetate |
|---|---|
| PubChem CID | 46416882 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | methyl 2-[3-(6,7,8,9-tetrahydro-5H-carbazole-1-carbonylamino)phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(NC(=O)c2cccc3c4c([nH]c23)CCCC4)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-27-20(25)13-28-15-7-4-6-14(12-15)23-22(26)18-10-5-9-17-16-8-2-3-11-19(16)24-21(17)18/h4-7,9-10,12,24H,2-3,8,11,13H2,1H3,(H,23,26) |
| InChIKey | GQMSPXZDRQLYLL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|