C19H18N4O7S — CID 55924141
4-[[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]sulfamoyl]benzoic acid (PubChem CID 55924141) has the molecular formula C19H18N4O7S and a molecular weight of 446.44 g/mol. Its IUPAC name is 4-[[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 55924141 |
| Molecular Formula | C19H18N4O7S |
| Molecular Weight | 446.44 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-[[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]sulfamoyl]benzoic acid |
| SMILES | O=C(CCN1C(=O)CNC1=O)Nc1ccc(NS(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H18N4O7S/c24-16(9-10-23-17(25)11-20-19(23)28)21-13-3-5-14(6-4-13)22-31(29,30)15-7-1-12(2-8-15)18(26)27/h1-8,22H,9-11H2,(H,20,28)(H,21,24)(H,26,27) |
| InChIKey | IZODAQXYYWOXQY-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 161.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.44 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|