C23H26N4O4 — CID 55963287
N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]-4-(4-methylphenyl)butanamide (PubChem CID 55963287) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]-4-(4-methylphenyl)butanamide.
| Compound Name | N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]-4-(4-methylphenyl)butanamide |
|---|---|
| PubChem CID | 55963287 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[4-[3-(2,5-dioxoimidazolidin-1-yl)propanoylamino]phenyl]-4-(4-methylphenyl)butanamide |
| SMILES | Cc1ccc(CCCC(=O)Nc2ccc(NC(=O)CCN3C(=O)CNC3=O)cc2)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-16-5-7-17(8-6-16)3-2-4-20(28)25-18-9-11-19(12-10-18)26-21(29)13-14-27-22(30)15-24-23(27)31/h5-12H,2-4,13-15H2,1H3,(H,24,31)(H,25,28)(H,26,29) |
| InChIKey | MWPGTQOVPQGMMP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|