C20H23Cl2N3O3S — CID 4571611
N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-piperidin-1-ylpropanamide (PubChem CID 4571611) has the molecular formula C20H23Cl2N3O3S and a molecular weight of 456.40 g/mol. Its IUPAC name is N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 4571611 |
| Molecular Formula | C20H23Cl2N3O3S |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-[4-[(3,5-dichlorophenyl)sulfamoyl]phenyl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)Nc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H23Cl2N3O3S/c21-15-12-16(22)14-18(13-15)24-29(27,28)19-6-4-17(5-7-19)23-20(26)8-11-25-9-2-1-3-10-25/h4-7,12-14,24H,1-3,8-11H2,(H,23,26) |
| InChIKey | HQNWQIJJLVMHAD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |