C18H20N2O5S — CID 55542289
4-[[4-(3-methylbutanoylamino)phenyl]sulfamoyl]benzoic acid (PubChem CID 55542289) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is 4-[[4-(3-methylbutanoylamino)phenyl]sulfamoyl]benzoic acid.
| Compound Name | 4-[[4-(3-methylbutanoylamino)phenyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 55542289 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[[4-(3-methylbutanoylamino)phenyl]sulfamoyl]benzoic acid |
| SMILES | CC(C)CC(=O)Nc1ccc(NS(=O)(=O)c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C18H20N2O5S/c1-12(2)11-17(21)19-14-5-7-15(8-6-14)20-26(24,25)16-9-3-13(4-10-16)18(22)23/h3-10,12,20H,11H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | DJGIYIQKWLPXCR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |