C18H15N3O4S — CID 35543957
3-cyano-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 35543957) has the molecular formula C18H15N3O4S and a molecular weight of 369.40 g/mol. Its IUPAC name is 3-cyano-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35543957 |
| Molecular Formula | C18H15N3O4S |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | 3-cyano-N-[4-[(2,5-dioxopyrrolidin-1-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)Nc2ccc(CN3C(=O)CCC3=O)cc2)c1 |
| InChI | InChI=1S/C18H15N3O4S/c19-11-14-2-1-3-16(10-14)26(24,25)20-15-6-4-13(5-7-15)12-21-17(22)8-9-18(21)23/h1-7,10,20H,8-9,12H2 |
| InChIKey | OWTKGILSIHVJLE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|