About azanylidyneazanium;1-chloro-3-methylbenzene;chloride
azanylidyneazanium;1-chloro-3-methylbenzene;chloride (PubChem CID 22991742) has the molecular formula C7H8Cl2N2
and a molecular weight of 191.06 g/mol. Its IUPAC name is azanylidyneazanium;1-chloro-3-methylbenzene;chloride.
Molecular Properties
| Compound Name | azanylidyneazanium;1-chloro-3-methylbenzene;chloride |
| PubChem CID | 22991742 |
| Molecular Formula | C7H8Cl2N2 |
| Molecular Weight | 191.06 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | azanylidyneazanium;1-chloro-3-methylbenzene;chloride |
| SMILES | Cc1cccc(Cl)c1.N#[NH+].[Cl-] |
| InChI | InChI=1S/C7H7Cl.ClH.N2/c1-6-3-2-4-7(8)5-6;;1-2/h2-5H,1H3;1H; |
| InChIKey | VDZDVZCVRMBEBH-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 47.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.06 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|
Analyze azanylidyneazanium;1-chloro-3-methylbenzene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyneazanium;1-chloro-3-methylbenzene;chloride?
The IUPAC name of azanylidyneazanium;1-chloro-3-methylbenzene;chloride (CID 22991742) is azanylidyneazanium;1-chloro-3-methylbenzene;chloride.
What is the SMILES notation for azanylidyneazanium;1-chloro-3-methylbenzene;chloride?
The canonical SMILES for azanylidyneazanium;1-chloro-3-methylbenzene;chloride is Cc1cccc(Cl)c1.N#[NH+].[Cl-].
What is the InChIKey of azanylidyneazanium;1-chloro-3-methylbenzene;chloride?
The InChIKey is VDZDVZCVRMBEBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl.ClH.N2/c1-6-3-2-4-7(8)5-6;;1-2/h2-5H,1H3;1H;.
What are the key properties of azanylidyneazanium;1-chloro-3-methylbenzene;chloride?
azanylidyneazanium;1-chloro-3-methylbenzene;chloride has a molecular weight of 191.06 g/mol, XLogP of -2.07, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyneazanium;1-chloro-3-methylbenzene;chloride is sourced from PubChem (CID 22991742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).