C9H7NO — CID 83479252
5-isocyano-2,3-dihydro-1-benzofuran (PubChem CID 83479252) has the molecular formula C9H7NO and a molecular weight of 145.16 g/mol. Its IUPAC name is 5-isocyano-2,3-dihydro-1-benzofuran.
| Compound Name | 5-isocyano-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 83479252 |
| Molecular Formula | C9H7NO |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 5-isocyano-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H7NO/c1-10-8-2-3-9-7(6-8)4-5-11-9/h2-3,6H,4-5H2 |
| InChIKey | XEQMDTFJXUEEDB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|