C12H11NO — CID 59118271
5-[(E)-1-isocyanoprop-1-en-2-yl]-2,3-dihydro-1-benzofuran (PubChem CID 59118271) has the molecular formula C12H11NO and a molecular weight of 185.23 g/mol. Its IUPAC name is 5-[(E)-1-isocyanoprop-1-en-2-yl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[(E)-1-isocyanoprop-1-en-2-yl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 59118271 |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 5-[(E)-1-isocyanoprop-1-en-2-yl]-2,3-dihydro-1-benzofuran |
| SMILES | [C-]#[N+]/C=C(\C)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C12H11NO/c1-9(8-13-2)10-3-4-12-11(7-10)5-6-14-12/h3-4,7-8H,5-6H2,1H3/b9-8+ |
| InChIKey | WYLIPZGDBYRCHS-CMDGGOBGSA-N |
| XLogP | 2.90 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|