C11H10O3 — CID 116821577
3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanal (PubChem CID 116821577) has the molecular formula C11H10O3 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanal.
| Compound Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanal |
|---|---|
| PubChem CID | 116821577 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 3-(2,3-dihydro-1-benzofuran-5-yl)-3-oxopropanal |
| SMILES | O=CCC(=O)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H10O3/c12-5-3-10(13)8-1-2-11-9(7-8)4-6-14-11/h1-2,5,7H,3-4,6H2 |
| InChIKey | IZADCKDEHUPILM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|