C14H17O3S+ — CID 154010141
1-(2,3-dihydro-1-benzofuran-5-yl)-2-(1,4-oxathian-4-ium-4-yl)ethanone (PubChem CID 154010141) has the molecular formula C14H17O3S+ and a molecular weight of 265.35 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(1,4-oxathian-4-ium-4-yl)ethanone.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(1,4-oxathian-4-ium-4-yl)ethanone |
|---|---|
| PubChem CID | 154010141 |
| Molecular Formula | C14H17O3S+ |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-5-yl)-2-(1,4-oxathian-4-ium-4-yl)ethanone |
| SMILES | O=C(C[S+]1CCOCC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C14H17O3S/c15-13(10-18-7-5-16-6-8-18)11-1-2-14-12(9-11)3-4-17-14/h1-2,9H,3-8,10H2/q+1 |
| InChIKey | RBGPEQXJEBCFNE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|